2,4-Difluoro-3-methoxylbenzoic acid - Names and Identifiers
Name | 2,4-Difluoro-3-methoxybenzoic acid
|
Synonyms | 2,4-DIFLUORO-3-METHOXYBENZOIC ACID 2,4-Difluoro-3-methoxybenzoic acid 2,4-Difluoro-3-Methoxy Benzoic Acid 2,4-Difluoro-3-methoxylbenzoic acid Benzoic acid,2,4-difluoro-3-methoxy- tert-butyl 3-allyl-3-hydroxyazetidine-46-carboxylate
|
CAS | 178974-97-5
|
EINECS | 1533716-785-6 |
InChI | InChI=1/C8H6F2O3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3H,1H3,(H,11,12) |
2,4-Difluoro-3-methoxylbenzoic acid - Physico-chemical Properties
Molecular Formula | C8H6F2O3
|
Molar Mass | 188.13 |
Density | 1.399±0.06 g/cm3(Predicted) |
Melting Point | 193-195°C |
Boling Point | 298.7±35.0 °C(Predicted) |
Flash Point | 134.5°C |
Water Solubility | Insoluble in water. |
Vapor Presure | 0.000557mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Light yellow |
pKa | 3.09±0.10(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.504 |
MDL | MFCD02258905 |
2,4-Difluoro-3-methoxylbenzoic acid - Risk and Safety
Hazard Symbols | Xi - Irritant
|
2,4-Difluoro-3-methoxylbenzoic acid - Introduction
2, the chemical formula is C9H8F2O3, which is an organic compound. Its properties are as follows:
1. Appearance: White to light yellow crystalline solid.
2. Solubility: soluble in organic solvents such as ethanol and dichloromethane, insoluble in water.
3. Melting Point: about 135-139 C.
4. Relative molecular mass: 196.16g/mol.
This compound is commonly used in the field of medicine and has the following uses:
1. Antibacterial agent: It has the ability to inhibit the growth of bacteria and fungi, and can be used in the preparation of antibacterial drugs and preservatives.
2. Pesticide intermediate: It can be used as an intermediate in the manufacture of pesticides and used in the synthesis of other organic synthetic pesticides and herbicides.
3. Pharmaceutical intermediate: It can be used as a synthetic intermediate for certain drugs, such as the preparation of anti-allergic drugs.
The main methods for preparing 2 acid are:
1. By the reaction of benzyl alcohol and hydrofluoric acid, 2,4-difluorobenzyl alcohol is generated. The resulting product was then esterified with methanol to give 2, onium acid.
2. By heating and hydrolyzing 2,4-difluorobenzonitrile, 2, 4-fluorobenzonitrile is obtained.
Regarding the safety information of 2, acid, the following matters need to be paid attention:
1. Need to use in a well-ventilated place, avoid inhaling its particles or steam.
2. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical help if necessary.
3. In the operation to avoid contact with oxidants, strong acid, alkali and other harmful substances.
4. Storage should be sealed in a cool, dry place, away from fire and flammable materials.
Last Update:2024-04-09 21:21:28